![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Yes.mp3 | 2021-08-24 22:00 | 11M | |
| 04 She Is Suffering.mp3 | 2021-08-24 22:00 | 11M | |
| Cover.jpg | 2021-08-24 22:00 | 58K | |
| 02 IfWhiteAmericaToldTheTruthForJustOneDayIt'sWorldWouldFallApart.mp3 | 2021-08-24 22:00 | 8.4M | |
| 03 Of Walking Abortion.mp3 | 2021-08-24 22:00 | 9.2M | |
| 11 Die In The Summertime.mp3 | 2021-08-24 22:00 | 7.1M | |
| 05 Archives Of Pain.mp3 | 2021-08-24 22:00 | 13M | |
| 06 Revol.mp3 | 2021-08-24 22:00 | 7.0M | |
| 07 4st 7lb.mp3 | 2021-08-24 22:00 | 12M | |
| 08 Mausoleum.mp3 | 2021-08-24 22:00 | 9.6M | |
| 09 Faster.mp3 | 2021-08-24 22:00 | 9.0M | |
| 10 This Is Yesterday.mp3 | 2021-08-24 22:00 | 9.1M | |
| 12 The Intense Humming Of Evil.mp3 | 2021-08-24 22:00 | 14M | |
| 13 P.C.P..mp3 | 2021-08-24 22:00 | 9.2M | |
| 14 Drug Drug Druggy (Live).mp3 | 2021-08-24 22:00 | 7.9M | |
| 15 Roses In The Hospital (Live).mp3 | 2021-08-24 22:00 | 11M | |
| 16 You Love Us (Live).mp3 | 2021-08-24 22:00 | 7.1M | |